cas: 348-31-2 — see every product listed under this CAS number, including other names
ETHYL 7-FLUOROINDOLE-2-CARBOXYLATE, 98% (CAS 348-31-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F835908-250MG |
| cas | 348-31-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 2351.27 Pln | |
| Fluorochem | 5g | 5266.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 7-fluoro-1H-indole-2-carboxylate (CAS 348-31-2) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: ethyl 7-fluoro-1H-indole-2-carboxylate. InChIKey: MOWXTDGMXSHYRL-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | ethyl 7-fluoro-1H-indole-2-carboxylate |
| InChIKey | MOWXTDGMXSHYRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=CC=C2)F |
Computed by PubChem (NCBI)