CAS 163631-01-4 is the registry number for 4-(4-Fluorophenyl)piperidine-2,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
4-(4-fluorophenyl)piperidine-2,6-dione (CAS 163631-01-4) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 4-(4-fluorophenyl)piperidine-2,6-dione. InChIKey: MXAMATMCPUOCEA-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 4-(4-fluorophenyl)piperidine-2,6-dione |
| InChIKey | MXAMATMCPUOCEA-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)