CAS 1267316-35-7 appears in our catalog under these names: 3-[(4-Fluorophenyl)methyl]pyrrolidine-2,5-dione, 95%, 3-((4-Fluorophenyl)methyl)pyrrolidine-2,5-dione, 95%, 3-((4-Fluorophenyl)methyl)pyrrolidine-2,5-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-[(4-fluorophenyl)methyl]pyrrolidine-2,5-dione (CAS 1267316-35-7) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 3-[(4-fluorophenyl)methyl]pyrrolidine-2,5-dione. InChIKey: FHFPYXBMRQZGPA-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methyl]pyrrolidine-2,5-dione |
| InChIKey | FHFPYXBMRQZGPA-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC1=O)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)