CAS 1951441-60-3 is the registry number for 7-Fluoro-1,1-dimethyl-4-nitro-1h-indene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
7-fluoro-1,1-dimethyl-4-nitroindene (CAS 1951441-60-3) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 7-fluoro-1,1-dimethyl-4-nitroindene. InChIKey: IVZDLYGCHGWCLM-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 7-fluoro-1,1-dimethyl-4-nitroindene |
| InChIKey | IVZDLYGCHGWCLM-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(C=CC(=C21)F)[N+](=O)[O-])C |
Computed by PubChem (NCBI)