Products 5159-07-9

CAS 5159-07-9 is the registry number for Methyl 6-Fluoroindole-3-acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(6-fluoro-1H-indol-3-yl)acetate (CAS 5159-07-9) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: methyl 2-(6-fluoro-1H-indol-3-yl)acetate. InChIKey: AVSUEWDZNVTLFF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10FNO2
Molecular weight207.20 g/mol
IUPAC namemethyl 2-(6-fluoro-1H-indol-3-yl)acetate
InChIKeyAVSUEWDZNVTLFF-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CNC2=C1C=CC(=C2)F

Computed by PubChem (NCBI)