CAS 145512-85-2 appears in our catalog under these names: Eprociclovir/ 99.86% (existing batch purity), Eprociclovir. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
2-amino-9-[[(1S,2R)-1,2-bis(hydroxymethyl)cyclopropyl]methyl]-1H-purin-6-one (CAS 145512-85-2) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: 2-amino-9-[[(1S,2R)-1,2-bis(hydroxymethyl)cyclopropyl]methyl]-1H-purin-6-one. InChIKey: JLYSZBQNRJVPEP-KGFZYKRKSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | 2-amino-9-[[(1S,2R)-1,2-bis(hydroxymethyl)cyclopropyl]methyl]-1H-purin-6-one |
| InChIKey | JLYSZBQNRJVPEP-KGFZYKRKSA-N |
| SMILES | C1[C@H]([C@@]1(CN2C=NC3=C2N=C(NC3=O)N)CO)CO |
Computed by PubChem (NCBI)