Products 183475-21-0

CAS 183475-21-0 appears in our catalog under these names: Famciclovir impurity 5, Guanine related compound 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-amino-6-oxo-1H-purin-9-yl)butyl acetate (CAS 183475-21-0) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: 4-(2-amino-6-oxo-1H-purin-9-yl)butyl acetate. InChIKey: VUBTXDYOPRDEME-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15N5O3
Molecular weight265.27 g/mol
IUPAC name4-(2-amino-6-oxo-1H-purin-9-yl)butyl acetate
InChIKeyVUBTXDYOPRDEME-UHFFFAOYSA-N
SMILESCC(=O)OCCCCN1C=NC2=C1N=C(NC2=O)N

Computed by PubChem (NCBI)