Products 1354782-02-7
CAS 1354782-02-7 appears in our catalog under these names: N–6–Methyl–2–deoxyadenosine–d3, N-6-Methyl-2-deoxyadenosine-d3, 99.94%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
(2R,3S,5R)-2-(hydroxymethyl)-5-[6-(trideuteriomethylamino)purin-9-yl]oxolan-3-ol (CAS 1354782-02-7) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 268.29 g/mol. IUPAC name: (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(trideuteriomethylamino)purin-9-yl]oxolan-3-ol. InChIKey: DYSDOYRQWBDGQQ-BXKFBODDSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(trideuteriomethylamino)purin-9-yl]oxolan-3-ol |
| InChIKey | DYSDOYRQWBDGQQ-BXKFBODDSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C2C(=NC=N1)N(C=N2)[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)