CAS 2102928-39-0 is the registry number for 2'-Deoxy-N-methyladenosine-15N5. Offered by: TRC. Available pack sizes: 25mg.
(2R,3S,5R)-2-(hydroxymethyl)-5-[6-(methyl(15N)amino)purin-9-yl]oxolan-3-ol (CAS 2102928-39-0) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 270.23 g/mol. IUPAC name: (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(methyl(15N)amino)purin-9-yl]oxolan-3-ol. InChIKey: DYSDOYRQWBDGQQ-SAKOLJHCSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 270.23 g/mol |
| IUPAC name | (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(methyl(15N)amino)purin-9-yl]oxolan-3-ol |
| InChIKey | DYSDOYRQWBDGQQ-SAKOLJHCSA-N |
| SMILES | C[15NH]C1=C2C(=[15N]C=[15N]1)[15N](C=[15N]2)[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)