cas: 24393-61-1 — see every product listed under this CAS number, including other names
Ethyl (2E)-3-(4-nitrophenyl)-2-propenoate, 98%, 98% (CAS 24393-61-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C5DD-1g |
| cas | 24393-61-1 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 381.20 Pln | |
| Chemat | 25g | 698.00 Pln | |
| Chemat | 100g | 2094.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (E)-3-(4-nitrophenyl)prop-2-enoate (CAS 24393-61-1) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: ethyl (E)-3-(4-nitrophenyl)prop-2-enoate. InChIKey: PFBQVGXIMLXCQB-VMPITWQZSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | ethyl (E)-3-(4-nitrophenyl)prop-2-enoate |
| InChIKey | PFBQVGXIMLXCQB-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)