cas: 24393-61-1 — see every product listed under this CAS number, including other names
Ethyl (E)-3-(4-nitrophenyl)acrylate 98% (CAS 24393-61-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1186823-5g |
| cas | 24393-61-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 481.62 Pln | |
| Ambeed | 25g | 898.81 Pln | |
| Ambeed | 100g | 2717.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1186823 |
Ethyl (E)-3-(4-nitrophenyl)prop-2-enoate (CAS 24393-61-1) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: ethyl (E)-3-(4-nitrophenyl)prop-2-enoate. InChIKey: PFBQVGXIMLXCQB-VMPITWQZSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | ethyl (E)-3-(4-nitrophenyl)prop-2-enoate |
| InChIKey | PFBQVGXIMLXCQB-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)