cas: 107259-05-2 — see every product listed under this CAS number, including other names
Ethyl 1-((tert-butoxycarbonyl)amino)cyclopropanecarboxylate 97% (CAS 107259-05-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173686-1g |
| cas | 107259-05-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 909.94 Pln | |
| Ambeed | 100g | 2689.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A173686 |
Ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (CAS 107259-05-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate. InChIKey: VBXFYABGAOGXRS-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| InChIKey | VBXFYABGAOGXRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)