cas: 107259-05-2 — see every product listed under this CAS number, including other names
Ethyl 1-((tert-butoxycarbonyl)amino)cyclopropanecarboxylate, 97% (CAS 107259-05-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237664-1G |
| cas | 107259-05-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 471.73 Pln | |
| Fluorochem | 25g | 1034.03 Pln | |
| Fluorochem | 100g | 3007.29 Pln | |
| Fluorochem | 500g | 8573.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (CAS 107259-05-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate. InChIKey: VBXFYABGAOGXRS-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| InChIKey | VBXFYABGAOGXRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)