CAS 54364-80-6 appears in our catalog under these names: Ethyl 2,3-dibromobenzoate, 95%, Ethyl 2,3-dibromobenzoate, ≥97.2%, ≥97.2%, Ethyl 2,3-dibromobenzoate, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
Ethyl 2,3-dibromobenzoate (CAS 54364-80-6) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: ethyl 2,3-dibromobenzoate. InChIKey: GBGOOSVSPZDQOO-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | ethyl 2,3-dibromobenzoate |
| InChIKey | GBGOOSVSPZDQOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)Br)Br |
Computed by PubChem (NCBI)