CAS 1806332-41-1 appears in our catalog under these names: Ethyl 2,3-difluoro-4-methoxybenzoate, 95%, Ethyl 2,3-difluoro-4-methoxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
Ethyl 2,3-difluoro-4-methoxybenzoate (CAS 1806332-41-1) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: ethyl 2,3-difluoro-4-methoxybenzoate. InChIKey: QNHBFJCNMCDXCN-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | ethyl 2,3-difluoro-4-methoxybenzoate |
| InChIKey | QNHBFJCNMCDXCN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)OC)F)F |
Computed by PubChem (NCBI)