CAS 2484889-17-8 appears in our catalog under these names: 2,6-Difluoro-3-propoxybenzoic acid, 95%, 2,6-Difluoro-3-propoxybenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,6-difluoro-3-propoxybenzoic acid (CAS 2484889-17-8) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 2,6-difluoro-3-propoxybenzoic acid. InChIKey: ZZWMZRPRIOTGIO-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 2,6-difluoro-3-propoxybenzoic acid |
| InChIKey | ZZWMZRPRIOTGIO-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C(=C(C=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)