CAS 1782612-50-3 appears in our catalog under these names: 4,5-Difluoro-2-(propan-2-yloxy)benzoic acid, 95%, 4,5-Difluoro-2-(propan-2-yloxy)benzoic acid, ≥95%, ≥95%, 4,5-Difluoro-2-(propan-2-yloxy)benzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4,5-difluoro-2-propan-2-yloxybenzoic acid (CAS 1782612-50-3) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 4,5-difluoro-2-propan-2-yloxybenzoic acid. InChIKey: BNVBZZHYTXVHSS-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 4,5-difluoro-2-propan-2-yloxybenzoic acid |
| InChIKey | BNVBZZHYTXVHSS-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1C(=O)O)F)F |
Computed by PubChem (NCBI)