CAS 2586126-14-7 is the registry number for Methyl 2,3-difluoro-5-methoxy-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 2,3-difluoro-5-methoxy-4-methylbenzoate (CAS 2586126-14-7) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: methyl 2,3-difluoro-5-methoxy-4-methylbenzoate. InChIKey: MIJBULIEWGHNBE-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | methyl 2,3-difluoro-5-methoxy-4-methylbenzoate |
| InChIKey | MIJBULIEWGHNBE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C(=O)OC)OC |
Computed by PubChem (NCBI)