cas: 773135-56-1 — see every product listed under this CAS number, including other names
Ethyl 2,3-difluoro-4-methylbenzoate, 97% (CAS 773135-56-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A674715-5g |
| cas | 773135-56-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5655.58 Pln | |
| AmBeed | 10g | 9548.56 Pln | |
| AmBeed | 25g | 18688.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 2,3-difluoro-4-methylbenzoate (CAS 773135-56-1) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: ethyl 2,3-difluoro-4-methylbenzoate. InChIKey: BTRWDPFKMBCWDA-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | ethyl 2,3-difluoro-4-methylbenzoate |
| InChIKey | BTRWDPFKMBCWDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)C)F)F |
Computed by PubChem (NCBI)