Ethyl 2,4,6-trichloronicotinate, 97%
cas: 1934657-78-9 — see every product listed under this CAS number, including other names
Ethyl 2,4,6-trichloronicotinate, 97% (CAS 1934657-78-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A603892-100mg |
| cas | 1934657-78-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 498.31 Pln | |
| Ambeed | 250mg | 798.69 Pln | |
| Ambeed | 1g | 2028.00 Pln | |
| BLDpharm | 100mg | 492.07 Pln | |
| BLDpharm | 250mg | 780.86 Pln | |
| BLDpharm | 1g | 1985.99 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1528.40 Pln | |
| Fluorochem | 100mg | 679.99 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2851.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 2,4,6-trichloropyridine-3-carboxylate (CAS 1934657-78-9) is a chemical compound with the molecular formula C8H6Cl3NO2 and a molecular weight of 254.5 g/mol. IUPAC name: ethyl 2,4,6-trichloropyridine-3-carboxylate. InChIKey: CYPJYAPPYRLXAT-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl3NO2 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | ethyl 2,4,6-trichloropyridine-3-carboxylate |
| InChIKey | CYPJYAPPYRLXAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)