CAS 181261-73-4 appears in our catalog under these names: Ethyl 4,5,6-trichloronicotinate, 95%, Ethyl 4,5,6–trichloronicotinate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
Ethyl 4,5,6-trichloropyridine-3-carboxylate (CAS 181261-73-4) is a chemical compound with the molecular formula C8H6Cl3NO2 and a molecular weight of 254.5 g/mol. IUPAC name: ethyl 4,5,6-trichloropyridine-3-carboxylate. InChIKey: XWJXULFLZWQHML-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl3NO2 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | ethyl 4,5,6-trichloropyridine-3-carboxylate |
| InChIKey | XWJXULFLZWQHML-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C(=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)