CAS 7397-28-6 is the registry number for N-(2,4,6-Trichloro-3-hydroxyphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(2,4,6-trichloro-3-hydroxyphenyl)acetamide (CAS 7397-28-6) is a chemical compound with the molecular formula C8H6Cl3NO2 and a molecular weight of 254.5 g/mol. IUPAC name: N-(2,4,6-trichloro-3-hydroxyphenyl)acetamide. InChIKey: DBUHHNIMGSEHSU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl3NO2 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | N-(2,4,6-trichloro-3-hydroxyphenyl)acetamide |
| InChIKey | DBUHHNIMGSEHSU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C=C1Cl)Cl)O)Cl |
Computed by PubChem (NCBI)