CAS 72652-34-7 appears in our catalog under these names: 1-(4-Acetyl-1h-pyrrol-2-yl)-2,2,2-trichloro-1-ethanone, 95%, 1-(4-Acetyl-1H-pyrrol-2-yl)-2,2,2-trichloro-1-ethanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-(4-acetyl-1H-pyrrol-2-yl)-2,2,2-trichloroethanone (CAS 72652-34-7) is a chemical compound with the molecular formula C8H6Cl3NO2 and a molecular weight of 254.5 g/mol. IUPAC name: 1-(4-acetyl-1H-pyrrol-2-yl)-2,2,2-trichloroethanone. InChIKey: OEXMOGNTZJXVPZ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl3NO2 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 1-(4-acetyl-1H-pyrrol-2-yl)-2,2,2-trichloroethanone |
| InChIKey | OEXMOGNTZJXVPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CNC(=C1)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)