Products 67858-52-0
CAS 67858-52-0 appears in our catalog under these names: 1-Methyl-5-(trichloroacetyl)-1h-pyrrole-3-carbaldehyde, 95%, 1-Methyl-5-(trichloroacetyl)-1H-pyrrole-3-carbaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 0,5g, 50mg.
1-methyl-5-(2,2,2-trichloroacetyl)pyrrole-3-carbaldehyde (CAS 67858-52-0) is a chemical compound with the molecular formula C8H6Cl3NO2 and a molecular weight of 254.5 g/mol. IUPAC name: 1-methyl-5-(2,2,2-trichloroacetyl)pyrrole-3-carbaldehyde. InChIKey: SXWJEGYHPGIILR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl3NO2 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 1-methyl-5-(2,2,2-trichloroacetyl)pyrrole-3-carbaldehyde |
| InChIKey | SXWJEGYHPGIILR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)C(Cl)(Cl)Cl)C=O |
Computed by PubChem (NCBI)