CAS 56882-52-1 appears in our catalog under these names: Ethyl 2,4-dichlorobenzoate, 95%, Ethyl 2,4–Dichlorobenzoate, ethyl 2,4-dichlorobenzoate, 98+%, 98+%, ETHYL 2,4-DICHLOROBENZOATE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 10g.
Ethyl 2,4-dichlorobenzoate (CAS 56882-52-1) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: ethyl 2,4-dichlorobenzoate. InChIKey: ZBBGAUHWTZKKQQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | ethyl 2,4-dichlorobenzoate |
| InChIKey | ZBBGAUHWTZKKQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)