CAS 1803805-37-9 appears in our catalog under these names: 2,4-Dichloro-5-methylbenzoic acid methyl ester, 95%, 2,4-Dichloro-5-methylbenzoic acid methyl ester, ≥95%, ≥95%, 2,4-Dichloro-5-methylbenzoic acid methyl ester, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 2,4-dichloro-5-methylbenzoate (CAS 1803805-37-9) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2,4-dichloro-5-methylbenzoate. InChIKey: JNVKVPLBWMLHPY-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2,4-dichloro-5-methylbenzoate |
| InChIKey | JNVKVPLBWMLHPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)