CAS 70185-30-7 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-1,3-dioxolane, 97%, 2-(3,5-Dichlorophenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
2-(3,5-dichlorophenyl)-1,3-dioxolane (CAS 70185-30-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-1,3-dioxolane. InChIKey: OKRZJWJFXHKWJZ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-1,3-dioxolane |
| InChIKey | OKRZJWJFXHKWJZ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)