Products 3556-00-1
CAS 3556-00-1 appears in our catalog under these names: 2-[(2,6-Dichlorophenoxy)methyl]oxirane, 96%, 2-(2,6-Dichlorophenoxymethyl)oxirane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
2-[(2,6-dichlorophenoxy)methyl]oxirane (CAS 3556-00-1) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 2-[(2,6-dichlorophenoxy)methyl]oxirane. InChIKey: VOYMDUMUZXIMNN-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenoxy)methyl]oxirane |
| InChIKey | VOYMDUMUZXIMNN-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)