CAS 43171-37-5 appears in our catalog under these names: 3,5-Dichloro-4-ethoxybenzaldehyde, 95%, 3,5-Dichloro-4-ethoxybenzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 2,5g.
3,5-dichloro-4-ethoxybenzaldehyde (CAS 43171-37-5) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 3,5-dichloro-4-ethoxybenzaldehyde. InChIKey: RREIHDZMWHOPJY-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 3,5-dichloro-4-ethoxybenzaldehyde |
| InChIKey | RREIHDZMWHOPJY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)