cas: 6974-10-3 — see every product listed under this CAS number, including other names
Ethyl 2-(1,3-dioxoisoindolin-2-yl)acetate, 98%, 98% (CAS 6974-10-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDZI-100mg |
| cas | 6974-10-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 520.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(1,3-dioxoisoindol-2-yl)acetate (CAS 6974-10-3) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: ethyl 2-(1,3-dioxoisoindol-2-yl)acetate. InChIKey: NYNCZOLNVTXTTP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | ethyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| InChIKey | NYNCZOLNVTXTTP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)