cas: 14741-71-0 — see every product listed under this CAS number, including other names
Ethyl 2-(1H-benzo[d]imidazol-2-yl)acetate 98% (CAS 14741-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A602453-1g |
| cas | 14741-71-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 25g | 1688.69 Pln | |
| Ambeed | 100g | 5248.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A602453 |
Ethyl 2-(1H-benzimidazol-2-yl)acetate (CAS 14741-71-0) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: ethyl 2-(1H-benzimidazol-2-yl)acetate. InChIKey: JTVPWPDLKUQDAU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | ethyl 2-(1H-benzimidazol-2-yl)acetate |
| InChIKey | JTVPWPDLKUQDAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)