Products 41022-54-2
CAS 41022-54-2 appears in our catalog under these names: Ethyl 2,4-dichlorophenylacetate, 98%, 98%, 2,4-Dichlorophenyl butyrate, 98%, (2,4-Dichlorophenyl)acetic acid ethyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 100mg.
Ethyl 2-(2,4-dichlorophenyl)acetate (CAS 41022-54-2) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 2-(2,4-dichlorophenyl)acetate. InChIKey: GQKNWRRUKBQMFY-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | ethyl 2-(2,4-dichlorophenyl)acetate |
| InChIKey | GQKNWRRUKBQMFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)