Products 80985-34-8
CAS 80985-34-8 is the registry number for 6,7-Bis(chloromethyl)-2,3-dihydro-1,4-benzodioxin, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6,7-bis(chloromethyl)-2,3-dihydro-1,4-benzodioxine (CAS 80985-34-8) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 6,7-bis(chloromethyl)-2,3-dihydro-1,4-benzodioxine. InChIKey: DPAYFSXIBAMHLR-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 6,7-bis(chloromethyl)-2,3-dihydro-1,4-benzodioxine |
| InChIKey | DPAYFSXIBAMHLR-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)CCl)CCl |
Computed by PubChem (NCBI)