CAS 25800-31-1 appears in our catalog under these names: Propyl 2,4-dichlorobenzoate, 95%, Propyl 2,4–dichlorobenzoate, Propyl 2,4-dichlorobenzoate, 97%, 97%, PROPYL 2,4-DICHLOROBENZOATE, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25mg, 5mg.
Propyl 2,4-dichlorobenzoate (CAS 25800-31-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: propyl 2,4-dichlorobenzoate. InChIKey: ZOIIQQAHABCSLU-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | propyl 2,4-dichlorobenzoate |
| InChIKey | ZOIIQQAHABCSLU-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)