Products 1642115-01-2
CAS 1642115-01-2 appears in our catalog under these names: 2,6-Dichloro-3-(1-methylethoxy)benzaldehyde, 95%, 2,6-Dichloro-3-(1-methylethoxy)benzaldehyde, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2,6-dichloro-3-propan-2-yloxybenzaldehyde (CAS 1642115-01-2) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2,6-dichloro-3-propan-2-yloxybenzaldehyde. InChIKey: AWBHCTLFWIXBRA-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2,6-dichloro-3-propan-2-yloxybenzaldehyde |
| InChIKey | AWBHCTLFWIXBRA-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)Cl)C=O)Cl |
Computed by PubChem (NCBI)