cas: 41022-54-2 — see every product listed under this CAS number, including other names
Ethyl 2,4-dichlorophenylacetate, 98%, 98% (CAS 41022-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZGC-250mg |
| cas | 41022-54-2 |
| size | 250mg |
| availability | 2500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 309.20 Pln | |
| Chemat | 500g | 1358.40 Pln | |
| Chemat | 100mg | 69.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(2,4-dichlorophenyl)acetate (CAS 41022-54-2) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 2-(2,4-dichlorophenyl)acetate. InChIKey: GQKNWRRUKBQMFY-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | ethyl 2-(2,4-dichlorophenyl)acetate |
| InChIKey | GQKNWRRUKBQMFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)