cas: 1261677-54-6 — see every product listed under this CAS number, including other names
Ethyl 2-(3-amino-4-bromophenyl)acetate, ≥95%, ≥95% (CAS 1261677-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLKE-100mg |
| cas | 1261677-54-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 1960.40 Pln | |
| Chemat | 5g | 4130.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(3-amino-4-bromophenyl)acetate (CAS 1261677-54-6) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: ethyl 2-(3-amino-4-bromophenyl)acetate. InChIKey: VSRCPHBPCYIHPF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | ethyl 2-(3-amino-4-bromophenyl)acetate |
| InChIKey | VSRCPHBPCYIHPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1)Br)N |
Computed by PubChem (NCBI)