cas: 80653-69-6 — see every product listed under this CAS number, including other names
Ethyl 2-(3-pyridinyl)-4-thiazoleacetate, 97%, 97% (CAS 80653-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G9OQ-100mg |
| cas | 80653-69-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate (CAS 80653-69-6) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: ethyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate. InChIKey: JGRCACXOIKCVIX-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | ethyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
| InChIKey | JGRCACXOIKCVIX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CSC(=N1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)