cas: 152362-31-7 — see every product listed under this CAS number, including other names
Ethyl 2-(4-amino-3-bromophenyl)acetate 97% (CAS 152362-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A753577-250mg |
| cas | 152362-31-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3012.56 Pln | |
| Ambeed | 10g | 4759.19 Pln | |
| Ambeed | 25g | 9403.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A753577 |
Ethyl 2-(4-amino-3-bromophenyl)acetate (CAS 152362-31-7) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: ethyl 2-(4-amino-3-bromophenyl)acetate. InChIKey: KGGLRUUIPVNGRB-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | ethyl 2-(4-amino-3-bromophenyl)acetate |
| InChIKey | KGGLRUUIPVNGRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1)N)Br |
Computed by PubChem (NCBI)