cas: 924312-09-4 — see every product listed under this CAS number, including other names
Ethyl 2-(4-bromo-2-fluorophenyl)acetate, 98%, 98% (CAS 924312-09-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1176UX-1g |
| cas | 924312-09-4 |
| size | 1g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 635.60 Pln | |
| Chemat | 10g | 1029.20 Pln | |
| Chemat | 25g | 2003.60 Pln | |
| Chemat | 100g | 5166.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-bromo-2-fluorophenyl)acetate (CAS 924312-09-4) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: ethyl 2-(4-bromo-2-fluorophenyl)acetate. InChIKey: NAIAJPLUTCZXKC-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2-fluorophenyl)acetate |
| InChIKey | NAIAJPLUTCZXKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)