cas: 1813-94-1 — see every product listed under this CAS number, including other names
Ethyl 2-(4-fluorophenyl),-2-oxoacetate, 95%, 95% (CAS 1813-94-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1133T0-250mg |
| cas | 1813-94-1 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 755.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-fluorophenyl)-2-oxoacetate (CAS 1813-94-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: ethyl 2-(4-fluorophenyl)-2-oxoacetate. InChIKey: RFKIEIUHZZILBI-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | ethyl 2-(4-fluorophenyl)-2-oxoacetate |
| InChIKey | RFKIEIUHZZILBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)