cas: 70080-54-5 — see every product listed under this CAS number, including other names
Ethyl 2-(4-hydroxyphenyl)-2-oxoacetate, 95%, 95% (CAS 70080-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JPXA-1g |
| cas | 70080-54-5 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 381.20 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 5g | 1643.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-hydroxyphenyl)-2-oxoacetate (CAS 70080-54-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: ethyl 2-(4-hydroxyphenyl)-2-oxoacetate. InChIKey: DZSXZYDBNQVSMU-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | ethyl 2-(4-hydroxyphenyl)-2-oxoacetate |
| InChIKey | DZSXZYDBNQVSMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)