cas: 70080-54-5 — see every product listed under this CAS number, including other names
Ethyl 2-(4-hydroxyphenyl)-2-oxoacetate, 98% (CAS 70080-54-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F459485-250MG |
| cas | 70080-54-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 2377.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(4-hydroxyphenyl)-2-oxoacetate (CAS 70080-54-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: ethyl 2-(4-hydroxyphenyl)-2-oxoacetate. InChIKey: DZSXZYDBNQVSMU-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | ethyl 2-(4-hydroxyphenyl)-2-oxoacetate |
| InChIKey | DZSXZYDBNQVSMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)