cas: 1375064-68-8 — see every product listed under this CAS number, including other names
Ethyl 2-Amino-4-(1-pyrazolyl)benzoate, >97%, >97% (CAS 1375064-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124ER-1g |
| cas | 1375064-68-8 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 952.40 Pln | |
| Chemat | 5g | 2286.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-4-pyrazol-1-ylbenzoate (CAS 1375064-68-8) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 2-amino-4-pyrazol-1-ylbenzoate. InChIKey: SRCSLEISLZCLAM-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 2-amino-4-pyrazol-1-ylbenzoate |
| InChIKey | SRCSLEISLZCLAM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)N2C=CC=N2)N |
Computed by PubChem (NCBI)