CAS 141072-09-5 is the registry number for Methyl 1-(3-methylbenzyl)-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
Methyl 1-[(3-methylphenyl)methyl]triazole-4-carboxylate (CAS 141072-09-5) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: methyl 1-[(3-methylphenyl)methyl]triazole-4-carboxylate. InChIKey: GUXMRWWLXFEIMJ-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | methyl 1-[(3-methylphenyl)methyl]triazole-4-carboxylate |
| InChIKey | GUXMRWWLXFEIMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C=C(N=N2)C(=O)OC |
Computed by PubChem (NCBI)