Products 141072-10-8

CAS 141072-10-8 is the registry number for Methyl 1-(2-methylbenzyl)-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-[(2-methylphenyl)methyl]triazole-4-carboxylate (CAS 141072-10-8) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: methyl 1-[(2-methylphenyl)methyl]triazole-4-carboxylate. InChIKey: NWXGTIWUNHVJFO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O2
Molecular weight231.25 g/mol
IUPAC namemethyl 1-[(2-methylphenyl)methyl]triazole-4-carboxylate
InChIKeyNWXGTIWUNHVJFO-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1CN2C=C(N=N2)C(=O)OC

Computed by PubChem (NCBI)