CAS 1152975-87-5 appears in our catalog under these names: 5-Isopropyl-1-pyridin-2-yl-1h-pyrazole-4-carboxylic acid, 95%, 5-(Propan-2-yl)-1-(pyridin-2-yl)-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylic acid (CAS 1152975-87-5) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylic acid. InChIKey: WIUFBOIAFKALFU-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylic acid |
| InChIKey | WIUFBOIAFKALFU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=NN1C2=CC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)