Products 926271-74-1

CAS 926271-74-1 is the registry number for 2-[3,5-Dimethyl-1-(pyridin-2-yl)-1h-pyrazol-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)acetic acid (CAS 926271-74-1) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)acetic acid. InChIKey: ATNQFACEBKQXSB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O2
Molecular weight231.25 g/mol
IUPAC name2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)acetic acid
InChIKeyATNQFACEBKQXSB-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C2=CC=CC=N2)C)CC(=O)O

Computed by PubChem (NCBI)