Products 341011-40-3
CAS 341011-40-3 is the registry number for methyl 2-(bromomethyl)-4-iodobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(bromomethyl)-4-iodobenzoate (CAS 341011-40-3) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: methyl 2-(bromomethyl)-4-iodobenzoate. InChIKey: NOTJJRMYBQBRQJ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-4-iodobenzoate |
| InChIKey | NOTJJRMYBQBRQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)I)CBr |
Computed by PubChem (NCBI)