Products 229028-10-8
CAS 229028-10-8 appears in our catalog under these names: Methyl 4–broMoMethyl–3–iodobenzoate, Methyl 4-(bromomethyl)-3-iodobenzoate, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 4-(bromomethyl)-3-iodobenzoate (CAS 229028-10-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: methyl 4-(bromomethyl)-3-iodobenzoate. InChIKey: WIEKIKAFLIHTCN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-3-iodobenzoate |
| InChIKey | WIEKIKAFLIHTCN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CBr)I |
Computed by PubChem (NCBI)